C28H25N5O2S — CID 155563031
3-(4-phenylphenyl)-1-pyrimidin-2-yl-8-(thiophen-2-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 155563031) has the molecular formula C28H25N5O2S and a molecular weight of 495.61 g/mol. Its IUPAC name is 3-(4-phenylphenyl)-1-pyrimidin-2-yl-8-(thiophen-2-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-(4-phenylphenyl)-1-pyrimidin-2-yl-8-(thiophen-2-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 155563031 |
| Molecular Formula | C28H25N5O2S |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 3-(4-phenylphenyl)-1-pyrimidin-2-yl-8-(thiophen-2-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1N(c2ccc(-c3ccccc3)cc2)C(=O)C2(CCN(Cc3cccs3)CC2)N1c1ncccn1 |
| InChI | InChI=1S/C28H25N5O2S/c34-25-28(13-17-31(18-14-28)20-24-8-4-19-36-24)33(26-29-15-5-16-30-26)27(35)32(25)23-11-9-22(10-12-23)21-6-2-1-3-7-21/h1-12,15-16,19H,13-14,17-18,20H2 |
| InChIKey | CBTFGYCZFGWWPE-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|