C27H15BrN6O4 — CID 155563080
8-[[3-(4-bromophenyl)-1-(2,4-dinitrophenyl)pyrazol-4-yl]methylidene]-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 155563080) has the molecular formula C27H15BrN6O4 and a molecular weight of 567.36 g/mol. Its IUPAC name is 8-[[3-(4-bromophenyl)-1-(2,4-dinitrophenyl)pyrazol-4-yl]methylidene]-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 8-[[3-(4-bromophenyl)-1-(2,4-dinitrophenyl)pyrazol-4-yl]methylidene]-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 155563080 |
| Molecular Formula | C27H15BrN6O4 |
| Molecular Weight | 567.36 g/mol |
| Exact Mass | 566.03 |
| IUPAC Name | 8-[[3-(4-bromophenyl)-1-(2,4-dinitrophenyl)pyrazol-4-yl]methylidene]-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | O=[N+]([O-])c1ccc(-n2cc(C=C3c4cccnc4-c4ncccc43)c(-c3ccc(Br)cc3)n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H15BrN6O4/c28-18-7-5-16(6-8-18)25-17(13-22-20-3-1-11-29-26(20)27-21(22)4-2-12-30-27)15-32(31-25)23-10-9-19(33(35)36)14-24(23)34(37)38/h1-15H |
| InChIKey | XWCRNNGBYQKITF-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 129.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.36 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|