C29H42N2O5 — CID 155563181
diethyl 2,6-dimethyl-4-[4-(5-piperidin-1-ylpentoxy)phenyl]-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 155563181) has the molecular formula C29H42N2O5 and a molecular weight of 498.66 g/mol. Its IUPAC name is diethyl 2,6-dimethyl-4-[4-(5-piperidin-1-ylpentoxy)phenyl]-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2,6-dimethyl-4-[4-(5-piperidin-1-ylpentoxy)phenyl]-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 155563181 |
| Molecular Formula | C29H42N2O5 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.31 |
| IUPAC Name | diethyl 2,6-dimethyl-4-[4-(5-piperidin-1-ylpentoxy)phenyl]-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1c1ccc(OCCCCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C29H42N2O5/c1-5-34-28(32)25-21(3)30-22(4)26(29(33)35-6-2)27(25)23-13-15-24(16-14-23)36-20-12-8-11-19-31-17-9-7-10-18-31/h13-16,27,30H,5-12,17-20H2,1-4H3 |
| InChIKey | LEFLUEYSKFGASD-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|