About 2-(8,8-dimethyl-2-oxopyrano[2,3-f]chromen-6-yl)oxy-N-methyl-N-pentylacetamide
2-(8,8-dimethyl-2-oxopyrano[2,3-f]chromen-6-yl)oxy-N-methyl-N-pentylacetamide (PubChem CID 155563211) has the molecular formula C22H27NO5
and a molecular weight of 385.46 g/mol. Its IUPAC name is 2-(8,8-dimethyl-2-oxopyrano[2,3-f]chromen-6-yl)oxy-N-methyl-N-pentylacetamide.
Molecular Properties
| Compound Name | 2-(8,8-dimethyl-2-oxopyrano[2,3-f]chromen-6-yl)oxy-N-methyl-N-pentylacetamide |
| PubChem CID | 155563211 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 2-(8,8-dimethyl-2-oxopyrano[2,3-f]chromen-6-yl)oxy-N-methyl-N-pentylacetamide |
| SMILES | CCCCCN(C)C(=O)COc1cc2ccc(=O)oc2c2c1OC(C)(C)C=C2 |
| InChI | InChI=1S/C22H27NO5/c1-5-6-7-12-23(4)18(24)14-26-17-13-15-8-9-19(25)27-20(15)16-10-11-22(2,3)28-21(16)17/h8-11,13H,5-7,12,14H2,1-4H3 |
| InChIKey | CIZCLRKDNWAISZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 2-(8,8-dimethyl-2-oxopyrano[2,3-f]chromen-6-yl)oxy-N-methyl-N-pentylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(8,8-dimethyl-2-oxopyrano[2,3-f]chromen-6-yl)oxy-N-methyl-N-pentylacetamide?
The IUPAC name of 2-(8,8-dimethyl-2-oxopyrano[2,3-f]chromen-6-yl)oxy-N-methyl-N-pentylacetamide (CID 155563211) is 2-(8,8-dimethyl-2-oxopyrano[2,3-f]chromen-6-yl)oxy-N-methyl-N-pentylacetamide.
What is the SMILES notation for 2-(8,8-dimethyl-2-oxopyrano[2,3-f]chromen-6-yl)oxy-N-methyl-N-pentylacetamide?
The canonical SMILES for 2-(8,8-dimethyl-2-oxopyrano[2,3-f]chromen-6-yl)oxy-N-methyl-N-pentylacetamide is CCCCCN(C)C(=O)COc1cc2ccc(=O)oc2c2c1OC(C)(C)C=C2.
What is the InChIKey of 2-(8,8-dimethyl-2-oxopyrano[2,3-f]chromen-6-yl)oxy-N-methyl-N-pentylacetamide?
The InChIKey is CIZCLRKDNWAISZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NO5/c1-5-6-7-12-23(4)18(24)14-26-17-13-15-8-9-19(25)27-20(15)16-10-11-22(2,3)28-21(16)17/h8-11,13H,5-7,12,14H2,1-4H3.
What are the key properties of 2-(8,8-dimethyl-2-oxopyrano[2,3-f]chromen-6-yl)oxy-N-methyl-N-pentylacetamide?
2-(8,8-dimethyl-2-oxopyrano[2,3-f]chromen-6-yl)oxy-N-methyl-N-pentylacetamide has a molecular weight of 385.46 g/mol, XLogP of 4.00, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8,8-dimethyl-2-oxopyrano[2,3-f]chromen-6-yl)oxy-N-methyl-N-pentylacetamide is sourced from PubChem (CID 155563211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).