C18H26O4 — CID 155563419
5-decanoyl-2,3-dihydroxy-6-methylcyclohepta-2,4,6-trien-1-one (PubChem CID 155563419) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is 5-decanoyl-2,3-dihydroxy-6-methylcyclohepta-2,4,6-trien-1-one.
| Compound Name | 5-decanoyl-2,3-dihydroxy-6-methylcyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 155563419 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 5-decanoyl-2,3-dihydroxy-6-methylcyclohepta-2,4,6-trien-1-one |
| SMILES | CCCCCCCCCC(=O)c1cc(O)c(O)c(=O)cc1C |
| InChI | InChI=1S/C18H26O4/c1-3-4-5-6-7-8-9-10-15(19)14-12-17(21)18(22)16(20)11-13(14)2/h11-12H,3-10H2,1-2H3,(H2,20,21,22) |
| InChIKey | QLWOWUJCNCOICO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|