About ethyl (2-acetamido-1,3-thiazol-5-yl)sulfanylformate
ethyl (2-acetamido-1,3-thiazol-5-yl)sulfanylformate (PubChem CID 155563443) has the molecular formula C8H10N2O3S2
and a molecular weight of 246.31 g/mol. Its IUPAC name is ethyl (2-acetamido-1,3-thiazol-5-yl)sulfanylformate.
Molecular Properties
| Compound Name | ethyl (2-acetamido-1,3-thiazol-5-yl)sulfanylformate |
| PubChem CID | 155563443 |
| Molecular Formula | C8H10N2O3S2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | ethyl (2-acetamido-1,3-thiazol-5-yl)sulfanylformate |
| SMILES | CCOC(=O)Sc1cnc(NC(C)=O)s1 |
| InChI | InChI=1S/C8H10N2O3S2/c1-3-13-8(12)15-6-4-9-7(14-6)10-5(2)11/h4H,3H2,1-2H3,(H,9,10,11) |
| InChIKey | HKTJWTUXBUULTK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2-acetamido-1,3-thiazol-5-yl)sulfanylformate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2-acetamido-1,3-thiazol-5-yl)sulfanylformate?
The IUPAC name of ethyl (2-acetamido-1,3-thiazol-5-yl)sulfanylformate (CID 155563443) is ethyl (2-acetamido-1,3-thiazol-5-yl)sulfanylformate.
What is the SMILES notation for ethyl (2-acetamido-1,3-thiazol-5-yl)sulfanylformate?
The canonical SMILES for ethyl (2-acetamido-1,3-thiazol-5-yl)sulfanylformate is CCOC(=O)Sc1cnc(NC(C)=O)s1.
What is the InChIKey of ethyl (2-acetamido-1,3-thiazol-5-yl)sulfanylformate?
The InChIKey is HKTJWTUXBUULTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3S2/c1-3-13-8(12)15-6-4-9-7(14-6)10-5(2)11/h4H,3H2,1-2H3,(H,9,10,11).
What are the key properties of ethyl (2-acetamido-1,3-thiazol-5-yl)sulfanylformate?
ethyl (2-acetamido-1,3-thiazol-5-yl)sulfanylformate has a molecular weight of 246.31 g/mol, XLogP of 2.35, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2-acetamido-1,3-thiazol-5-yl)sulfanylformate is sourced from PubChem (CID 155563443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).