C23H26N2O3 — CID 155563472
4-[5-(3,5-ditert-butylphenyl)-1,2,4-oxadiazol-3-yl]benzoic acid (PubChem CID 155563472) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 4-[5-(3,5-ditert-butylphenyl)-1,2,4-oxadiazol-3-yl]benzoic acid.
| Compound Name | 4-[5-(3,5-ditert-butylphenyl)-1,2,4-oxadiazol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 155563472 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 4-[5-(3,5-ditert-butylphenyl)-1,2,4-oxadiazol-3-yl]benzoic acid |
| SMILES | CC(C)(C)c1cc(-c2nc(-c3ccc(C(=O)O)cc3)no2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H26N2O3/c1-22(2,3)17-11-16(12-18(13-17)23(4,5)6)20-24-19(25-28-20)14-7-9-15(10-8-14)21(26)27/h7-13H,1-6H3,(H,26,27) |
| InChIKey | JWKZWINZDQTXSF-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |