C9H10N2O3 — CID 155563594
1-[3-(furan-3-yl)-1H-pyrazol-5-yl]ethane-1,2-diol (PubChem CID 155563594) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is 1-[3-(furan-3-yl)-1H-pyrazol-5-yl]ethane-1,2-diol.
| Compound Name | 1-[3-(furan-3-yl)-1H-pyrazol-5-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 155563594 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 1-[3-(furan-3-yl)-1H-pyrazol-5-yl]ethane-1,2-diol |
| SMILES | OCC(O)c1cc(-c2ccoc2)n[nH]1 |
| InChI | InChI=1S/C9H10N2O3/c12-4-9(13)8-3-7(10-11-8)6-1-2-14-5-6/h1-3,5,9,12-13H,4H2,(H,10,11) |
| InChIKey | PNXDDFQDPXQVTR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |