About 2,4-diphenyl-5H-indeno[1,2-b]pyridin-8-ol
2,4-diphenyl-5H-indeno[1,2-b]pyridin-8-ol (PubChem CID 155563648) has the molecular formula C24H17NO
and a molecular weight of 335.41 g/mol. Its IUPAC name is 2,4-diphenyl-5H-indeno[1,2-b]pyridin-8-ol.
Molecular Properties
| Compound Name | 2,4-diphenyl-5H-indeno[1,2-b]pyridin-8-ol |
| PubChem CID | 155563648 |
| Molecular Formula | C24H17NO |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 2,4-diphenyl-5H-indeno[1,2-b]pyridin-8-ol |
| SMILES | Oc1ccc2c(c1)-c1nc(-c3ccccc3)cc(-c3ccccc3)c1C2 |
| InChI | InChI=1S/C24H17NO/c26-19-12-11-18-13-22-20(16-7-3-1-4-8-16)15-23(17-9-5-2-6-10-17)25-24(22)21(18)14-19/h1-12,14-15,26H,13H2 |
| InChIKey | WUPPJHLVLOKAQU-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-diphenyl-5H-indeno[1,2-b]pyridin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diphenyl-5H-indeno[1,2-b]pyridin-8-ol?
The IUPAC name of 2,4-diphenyl-5H-indeno[1,2-b]pyridin-8-ol (CID 155563648) is 2,4-diphenyl-5H-indeno[1,2-b]pyridin-8-ol.
What is the SMILES notation for 2,4-diphenyl-5H-indeno[1,2-b]pyridin-8-ol?
The canonical SMILES for 2,4-diphenyl-5H-indeno[1,2-b]pyridin-8-ol is Oc1ccc2c(c1)-c1nc(-c3ccccc3)cc(-c3ccccc3)c1C2.
What is the InChIKey of 2,4-diphenyl-5H-indeno[1,2-b]pyridin-8-ol?
The InChIKey is WUPPJHLVLOKAQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17NO/c26-19-12-11-18-13-22-20(16-7-3-1-4-8-16)15-23(17-9-5-2-6-10-17)25-24(22)21(18)14-19/h1-12,14-15,26H,13H2.
What are the key properties of 2,4-diphenyl-5H-indeno[1,2-b]pyridin-8-ol?
2,4-diphenyl-5H-indeno[1,2-b]pyridin-8-ol has a molecular weight of 335.41 g/mol, XLogP of 5.69, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diphenyl-5H-indeno[1,2-b]pyridin-8-ol is sourced from PubChem (CID 155563648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).