About 2-N,3-N-bis(3-nitrophenyl)quinoxaline-2,3-diamine
2-N,3-N-bis(3-nitrophenyl)quinoxaline-2,3-diamine (PubChem CID 155563805) has the molecular formula C20H14N6O4
and a molecular weight of 402.37 g/mol. Its IUPAC name is 2-N,3-N-bis(3-nitrophenyl)quinoxaline-2,3-diamine.
Molecular Properties
| Compound Name | 2-N,3-N-bis(3-nitrophenyl)quinoxaline-2,3-diamine |
| PubChem CID | 155563805 |
| Molecular Formula | C20H14N6O4 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 2-N,3-N-bis(3-nitrophenyl)quinoxaline-2,3-diamine |
| SMILES | O=[N+]([O-])c1cccc(Nc2nc3ccccc3nc2Nc2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C20H14N6O4/c27-25(28)15-7-3-5-13(11-15)21-19-20(24-18-10-2-1-9-17(18)23-19)22-14-6-4-8-16(12-14)26(29)30/h1-12H,(H,21,23)(H,22,24) |
| InChIKey | BNZVEAOTQDKJTB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-N,3-N-bis(3-nitrophenyl)quinoxaline-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,3-N-bis(3-nitrophenyl)quinoxaline-2,3-diamine?
The IUPAC name of 2-N,3-N-bis(3-nitrophenyl)quinoxaline-2,3-diamine (CID 155563805) is 2-N,3-N-bis(3-nitrophenyl)quinoxaline-2,3-diamine.
What is the SMILES notation for 2-N,3-N-bis(3-nitrophenyl)quinoxaline-2,3-diamine?
The canonical SMILES for 2-N,3-N-bis(3-nitrophenyl)quinoxaline-2,3-diamine is O=[N+]([O-])c1cccc(Nc2nc3ccccc3nc2Nc2cccc([N+](=O)[O-])c2)c1.
What is the InChIKey of 2-N,3-N-bis(3-nitrophenyl)quinoxaline-2,3-diamine?
The InChIKey is BNZVEAOTQDKJTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N6O4/c27-25(28)15-7-3-5-13(11-15)21-19-20(24-18-10-2-1-9-17(18)23-19)22-14-6-4-8-16(12-14)26(29)30/h1-12H,(H,21,23)(H,22,24).
What are the key properties of 2-N,3-N-bis(3-nitrophenyl)quinoxaline-2,3-diamine?
2-N,3-N-bis(3-nitrophenyl)quinoxaline-2,3-diamine has a molecular weight of 402.37 g/mol, XLogP of 4.93, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,3-N-bis(3-nitrophenyl)quinoxaline-2,3-diamine is sourced from PubChem (CID 155563805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).