C31H36N2O2 — CID 155563934
N-(2,2-diphenylethyl)-3-[(1R,9R,13R)-4-hydroxy-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]propanamide (PubChem CID 155563934) has the molecular formula C31H36N2O2 and a molecular weight of 468.64 g/mol. Its IUPAC name is N-(2,2-diphenylethyl)-3-[(1R,9R,13R)-4-hydroxy-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]propanamide.
| Compound Name | N-(2,2-diphenylethyl)-3-[(1R,9R,13R)-4-hydroxy-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]propanamide |
|---|---|
| PubChem CID | 155563934 |
| Molecular Formula | C31H36N2O2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | N-(2,2-diphenylethyl)-3-[(1R,9R,13R)-4-hydroxy-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]propanamide |
| SMILES | C[C@H]1[C@H]2Cc3ccc(O)cc3[C@]1(C)CCN2CCC(=O)NCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H36N2O2/c1-22-29-19-25-13-14-26(34)20-28(25)31(22,2)16-18-33(29)17-15-30(35)32-21-27(23-9-5-3-6-10-23)24-11-7-4-8-12-24/h3-14,20,22,27,29,34H,15-19,21H2,1-2H3,(H,32,35)/t22-,29+,31+/m0/s1 |
| InChIKey | LUJZXARUKQUEFU-JOHVVKFNSA-N |
| XLogP | 5.25 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |