C28H33FO — CID 155564002
(1R,3aR,6aR)-3a-[1-(2-fluorophenyl)ethenyl]-5-hexyl-4-phenyl-2,3,6,6a-tetrahydro-1H-pentalen-1-ol (PubChem CID 155564002) has the molecular formula C28H33FO and a molecular weight of 404.57 g/mol. Its IUPAC name is (1R,3aR,6aR)-3a-[1-(2-fluorophenyl)ethenyl]-5-hexyl-4-phenyl-2,3,6,6a-tetrahydro-1H-pentalen-1-ol.
| Compound Name | (1R,3aR,6aR)-3a-[1-(2-fluorophenyl)ethenyl]-5-hexyl-4-phenyl-2,3,6,6a-tetrahydro-1H-pentalen-1-ol |
|---|---|
| PubChem CID | 155564002 |
| Molecular Formula | C28H33FO |
| Molecular Weight | 404.57 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | (1R,3aR,6aR)-3a-[1-(2-fluorophenyl)ethenyl]-5-hexyl-4-phenyl-2,3,6,6a-tetrahydro-1H-pentalen-1-ol |
| SMILES | C=C(c1ccccc1F)[C@@]12CC[C@@H](O)[C@@H]1CC(CCCCCC)=C2c1ccccc1 |
| InChI | InChI=1S/C28H33FO/c1-3-4-5-7-14-22-19-24-26(30)17-18-28(24,27(22)21-12-8-6-9-13-21)20(2)23-15-10-11-16-25(23)29/h6,8-13,15-16,24,26,30H,2-5,7,14,17-19H2,1H3/t24-,26+,28-/m0/s1 |
| InChIKey | ATVZSCKUYRFCTH-YIOBJHAYSA-N |
| XLogP | 7.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.57 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|