C24H27F3N4O2S — CID 155564026
N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-6-(1,1-dioxothian-4-yl)-2,8-dimethylquinazolin-4-amine (PubChem CID 155564026) has the molecular formula C24H27F3N4O2S and a molecular weight of 492.57 g/mol. Its IUPAC name is N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-6-(1,1-dioxothian-4-yl)-2,8-dimethylquinazolin-4-amine.
| Compound Name | N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-6-(1,1-dioxothian-4-yl)-2,8-dimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 155564026 |
| Molecular Formula | C24H27F3N4O2S |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-6-(1,1-dioxothian-4-yl)-2,8-dimethylquinazolin-4-amine |
| SMILES | Cc1nc(N[C@H](C)c2cc(N)cc(C(F)(F)F)c2)c2cc(C3CCS(=O)(=O)CC3)cc(C)c2n1 |
| InChI | InChI=1S/C24H27F3N4O2S/c1-13-8-18(16-4-6-34(32,33)7-5-16)11-21-22(13)30-15(3)31-23(21)29-14(2)17-9-19(24(25,26)27)12-20(28)10-17/h8-12,14,16H,4-7,28H2,1-3H3,(H,29,30,31)/t14-/m1/s1 |
| InChIKey | QTURMKCASWZJPO-CQSZACIVSA-N |
| XLogP | 5.31 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|