About 6-bromo-2-imidazo[1,2-a]pyridin-6-yl-N-(2-methoxyethyl)imidazo[1,2-a]pyridin-3-amine
6-bromo-2-imidazo[1,2-a]pyridin-6-yl-N-(2-methoxyethyl)imidazo[1,2-a]pyridin-3-amine (PubChem CID 155564083) has the molecular formula C17H16BrN5O
and a molecular weight of 386.25 g/mol. Its IUPAC name is 6-bromo-2-imidazo[1,2-a]pyridin-6-yl-N-(2-methoxyethyl)imidazo[1,2-a]pyridin-3-amine.
Molecular Properties
| Compound Name | 6-bromo-2-imidazo[1,2-a]pyridin-6-yl-N-(2-methoxyethyl)imidazo[1,2-a]pyridin-3-amine |
| PubChem CID | 155564083 |
| Molecular Formula | C17H16BrN5O |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 6-bromo-2-imidazo[1,2-a]pyridin-6-yl-N-(2-methoxyethyl)imidazo[1,2-a]pyridin-3-amine |
| SMILES | COCCNc1c(-c2ccc3nccn3c2)nc2ccc(Br)cn12 |
| InChI | InChI=1S/C17H16BrN5O/c1-24-9-7-20-17-16(21-15-5-3-13(18)11-23(15)17)12-2-4-14-19-6-8-22(14)10-12/h2-6,8,10-11,20H,7,9H2,1H3 |
| InChIKey | JQKBMVLJVOMTLG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-2-imidazo[1,2-a]pyridin-6-yl-N-(2-methoxyethyl)imidazo[1,2-a]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-imidazo[1,2-a]pyridin-6-yl-N-(2-methoxyethyl)imidazo[1,2-a]pyridin-3-amine?
The IUPAC name of 6-bromo-2-imidazo[1,2-a]pyridin-6-yl-N-(2-methoxyethyl)imidazo[1,2-a]pyridin-3-amine (CID 155564083) is 6-bromo-2-imidazo[1,2-a]pyridin-6-yl-N-(2-methoxyethyl)imidazo[1,2-a]pyridin-3-amine.
What is the SMILES notation for 6-bromo-2-imidazo[1,2-a]pyridin-6-yl-N-(2-methoxyethyl)imidazo[1,2-a]pyridin-3-amine?
The canonical SMILES for 6-bromo-2-imidazo[1,2-a]pyridin-6-yl-N-(2-methoxyethyl)imidazo[1,2-a]pyridin-3-amine is COCCNc1c(-c2ccc3nccn3c2)nc2ccc(Br)cn12.
What is the InChIKey of 6-bromo-2-imidazo[1,2-a]pyridin-6-yl-N-(2-methoxyethyl)imidazo[1,2-a]pyridin-3-amine?
The InChIKey is JQKBMVLJVOMTLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16BrN5O/c1-24-9-7-20-17-16(21-15-5-3-13(18)11-23(15)17)12-2-4-14-19-6-8-22(14)10-12/h2-6,8,10-11,20H,7,9H2,1H3.
What are the key properties of 6-bromo-2-imidazo[1,2-a]pyridin-6-yl-N-(2-methoxyethyl)imidazo[1,2-a]pyridin-3-amine?
6-bromo-2-imidazo[1,2-a]pyridin-6-yl-N-(2-methoxyethyl)imidazo[1,2-a]pyridin-3-amine has a molecular weight of 386.25 g/mol, XLogP of 3.47, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-imidazo[1,2-a]pyridin-6-yl-N-(2-methoxyethyl)imidazo[1,2-a]pyridin-3-amine is sourced from PubChem (CID 155564083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).