C33H43N3O3 — CID 155564213
ethyl (1R,4S,5R,9S,10R,13S,14E)-5,9,13-trimethyl-14-[(E)-3-quinoxalin-6-ylprop-2-enoxy]iminotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 155564213) has the molecular formula C33H43N3O3 and a molecular weight of 529.73 g/mol. Its IUPAC name is ethyl (1R,4S,5R,9S,10R,13S,14E)-5,9,13-trimethyl-14-[(E)-3-quinoxalin-6-ylprop-2-enoxy]iminotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | ethyl (1R,4S,5R,9S,10R,13S,14E)-5,9,13-trimethyl-14-[(E)-3-quinoxalin-6-ylprop-2-enoxy]iminotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 155564213 |
| Molecular Formula | C33H43N3O3 |
| Molecular Weight | 529.73 g/mol |
| Exact Mass | 529.33 |
| IUPAC Name | ethyl (1R,4S,5R,9S,10R,13S,14E)-5,9,13-trimethyl-14-[(E)-3-quinoxalin-6-ylprop-2-enoxy]iminotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3CC[C@@]4(C)C[C@]3(CC[C@@H]21)C/C4=N\OC/C=C/c1ccc2nccnc2c1 |
| InChI | InChI=1S/C33H43N3O3/c1-5-38-29(37)32(4)14-7-13-31(3)26(32)12-16-33-21-28(30(2,22-33)15-11-27(31)33)36-39-19-6-8-23-9-10-24-25(20-23)35-18-17-34-24/h6,8-10,17-18,20,26-27H,5,7,11-16,19,21-22H2,1-4H3/b8-6+,36-28+/t26-,27-,30-,31+,32+,33-/m0/s1 |
| InChIKey | PHRRRRFWKDCSPE-YEKGKCOQSA-N |
| XLogP | 7.38 |
| TPSA | 73.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.73 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|