C20H16Cl2F6N4O2 — CID 155564454
1-N,4-N-bis[2-chloro-5-(trifluoromethyl)phenyl]piperazine-1,4-dicarboxamide (PubChem CID 155564454) has the molecular formula C20H16Cl2F6N4O2 and a molecular weight of 529.27 g/mol. Its IUPAC name is 1-N,4-N-bis[2-chloro-5-(trifluoromethyl)phenyl]piperazine-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[2-chloro-5-(trifluoromethyl)phenyl]piperazine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 155564454 |
| Molecular Formula | C20H16Cl2F6N4O2 |
| Molecular Weight | 529.27 g/mol |
| Exact Mass | 528.06 |
| IUPAC Name | 1-N,4-N-bis[2-chloro-5-(trifluoromethyl)phenyl]piperazine-1,4-dicarboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1Cl)N1CCN(C(=O)Nc2cc(C(F)(F)F)ccc2Cl)CC1 |
| InChI | InChI=1S/C20H16Cl2F6N4O2/c21-13-3-1-11(19(23,24)25)9-15(13)29-17(33)31-5-7-32(8-6-31)18(34)30-16-10-12(20(26,27)28)2-4-14(16)22/h1-4,9-10H,5-8H2,(H,29,33)(H,30,34) |
| InChIKey | HNXWGGXGUUXULB-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.27 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |