C24H26N6O4S — CID 155564465
8-[4-(4-phenylpiperazin-1-yl)sulfonylphenyl]-1-propyl-3,7-dihydropurine-2,6-dione (PubChem CID 155564465) has the molecular formula C24H26N6O4S and a molecular weight of 494.58 g/mol. Its IUPAC name is 8-[4-(4-phenylpiperazin-1-yl)sulfonylphenyl]-1-propyl-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-[4-(4-phenylpiperazin-1-yl)sulfonylphenyl]-1-propyl-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 155564465 |
| Molecular Formula | C24H26N6O4S |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 8-[4-(4-phenylpiperazin-1-yl)sulfonylphenyl]-1-propyl-3,7-dihydropurine-2,6-dione |
| SMILES | CCCn1c(=O)[nH]c2nc(-c3ccc(S(=O)(=O)N4CCN(c5ccccc5)CC4)cc3)[nH]c2c1=O |
| InChI | InChI=1S/C24H26N6O4S/c1-2-12-30-23(31)20-22(27-24(30)32)26-21(25-20)17-8-10-19(11-9-17)35(33,34)29-15-13-28(14-16-29)18-6-4-3-5-7-18/h3-11H,2,12-16H2,1H3,(H,25,26)(H,27,32) |
| InChIKey | TWEQUQLAIKTEEB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 124.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |