C21H24N6O3 — CID 155564488
1-[4-[5-(cyclopropylmethyl)-6-oxo-6a,7,9,10-tetrahydro-[1,4]oxazino[3,4-h]pteridin-2-yl]phenyl]-3-methylurea (PubChem CID 155564488) has the molecular formula C21H24N6O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is 1-[4-[5-(cyclopropylmethyl)-6-oxo-6a,7,9,10-tetrahydro-[1,4]oxazino[3,4-h]pteridin-2-yl]phenyl]-3-methylurea.
| Compound Name | 1-[4-[5-(cyclopropylmethyl)-6-oxo-6a,7,9,10-tetrahydro-[1,4]oxazino[3,4-h]pteridin-2-yl]phenyl]-3-methylurea |
|---|---|
| PubChem CID | 155564488 |
| Molecular Formula | C21H24N6O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 1-[4-[5-(cyclopropylmethyl)-6-oxo-6a,7,9,10-tetrahydro-[1,4]oxazino[3,4-h]pteridin-2-yl]phenyl]-3-methylurea |
| SMILES | CNC(=O)Nc1ccc(-c2ncc3c(n2)N2CCOCC2C(=O)N3CC2CC2)cc1 |
| InChI | InChI=1S/C21H24N6O3/c1-22-21(29)24-15-6-4-14(5-7-15)18-23-10-16-19(25-18)26-8-9-30-12-17(26)20(28)27(16)11-13-2-3-13/h4-7,10,13,17H,2-3,8-9,11-12H2,1H3,(H2,22,24,29) |
| InChIKey | NHLNPZZTMQBPOC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |