About [3-(4-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-3-oxopropyl] N-(pyridin-3-ylmethyl)carbamodithioate
[3-(4-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-3-oxopropyl] N-(pyridin-3-ylmethyl)carbamodithioate (PubChem CID 155564558) has the molecular formula C17H15BrN4OS2
and a molecular weight of 435.37 g/mol. Its IUPAC name is [3-(4-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-3-oxopropyl] N-(pyridin-3-ylmethyl)carbamodithioate.
Molecular Properties
| Compound Name | [3-(4-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-3-oxopropyl] N-(pyridin-3-ylmethyl)carbamodithioate |
| PubChem CID | 155564558 |
| Molecular Formula | C17H15BrN4OS2 |
| Molecular Weight | 435.37 g/mol |
| Exact Mass | 433.99 |
| IUPAC Name | [3-(4-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-3-oxopropyl] N-(pyridin-3-ylmethyl)carbamodithioate |
| SMILES | O=C(CCSC(=S)NCc1cccnc1)c1c[nH]c2nccc(Br)c12 |
| InChI | InChI=1S/C17H15BrN4OS2/c18-13-3-6-20-16-15(13)12(10-21-16)14(23)4-7-25-17(24)22-9-11-2-1-5-19-8-11/h1-3,5-6,8,10H,4,7,9H2,(H,20,21)(H,22,24) |
| InChIKey | JMNAFTAFDWLERV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_carbam_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-3-oxopropyl] N-(pyridin-3-ylmethyl)carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-3-oxopropyl] N-(pyridin-3-ylmethyl)carbamodithioate?
The IUPAC name of [3-(4-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-3-oxopropyl] N-(pyridin-3-ylmethyl)carbamodithioate (CID 155564558) is [3-(4-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-3-oxopropyl] N-(pyridin-3-ylmethyl)carbamodithioate.
What is the SMILES notation for [3-(4-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-3-oxopropyl] N-(pyridin-3-ylmethyl)carbamodithioate?
The canonical SMILES for [3-(4-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-3-oxopropyl] N-(pyridin-3-ylmethyl)carbamodithioate is O=C(CCSC(=S)NCc1cccnc1)c1c[nH]c2nccc(Br)c12.
What is the InChIKey of [3-(4-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-3-oxopropyl] N-(pyridin-3-ylmethyl)carbamodithioate?
The InChIKey is JMNAFTAFDWLERV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15BrN4OS2/c18-13-3-6-20-16-15(13)12(10-21-16)14(23)4-7-25-17(24)22-9-11-2-1-5-19-8-11/h1-3,5-6,8,10H,4,7,9H2,(H,20,21)(H,22,24).
What are the key properties of [3-(4-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-3-oxopropyl] N-(pyridin-3-ylmethyl)carbamodithioate?
[3-(4-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-3-oxopropyl] N-(pyridin-3-ylmethyl)carbamodithioate has a molecular weight of 435.37 g/mol, XLogP of 4.10, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-3-oxopropyl] N-(pyridin-3-ylmethyl)carbamodithioate is sourced from PubChem (CID 155564558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).