About O-[(2,4-dichlorophenyl)-phenylmethyl]hydroxylamine
O-[(2,4-dichlorophenyl)-phenylmethyl]hydroxylamine (PubChem CID 155564614) has the molecular formula C13H11Cl2NO
and a molecular weight of 268.14 g/mol. Its IUPAC name is O-[(2,4-dichlorophenyl)-phenylmethyl]hydroxylamine.
Molecular Properties
| Compound Name | O-[(2,4-dichlorophenyl)-phenylmethyl]hydroxylamine |
| PubChem CID | 155564614 |
| Molecular Formula | C13H11Cl2NO |
| Molecular Weight | 268.14 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | O-[(2,4-dichlorophenyl)-phenylmethyl]hydroxylamine |
| SMILES | NOC(c1ccccc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H11Cl2NO/c14-10-6-7-11(12(15)8-10)13(17-16)9-4-2-1-3-5-9/h1-8,13H,16H2 |
| InChIKey | XCHGGCIDOABCOF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.14 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-[(2,4-dichlorophenyl)-phenylmethyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[(2,4-dichlorophenyl)-phenylmethyl]hydroxylamine?
The IUPAC name of O-[(2,4-dichlorophenyl)-phenylmethyl]hydroxylamine (CID 155564614) is O-[(2,4-dichlorophenyl)-phenylmethyl]hydroxylamine.
What is the SMILES notation for O-[(2,4-dichlorophenyl)-phenylmethyl]hydroxylamine?
The canonical SMILES for O-[(2,4-dichlorophenyl)-phenylmethyl]hydroxylamine is NOC(c1ccccc1)c1ccc(Cl)cc1Cl.
What is the InChIKey of O-[(2,4-dichlorophenyl)-phenylmethyl]hydroxylamine?
The InChIKey is XCHGGCIDOABCOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11Cl2NO/c14-10-6-7-11(12(15)8-10)13(17-16)9-4-2-1-3-5-9/h1-8,13H,16H2.
What are the key properties of O-[(2,4-dichlorophenyl)-phenylmethyl]hydroxylamine?
O-[(2,4-dichlorophenyl)-phenylmethyl]hydroxylamine has a molecular weight of 268.14 g/mol, XLogP of 3.97, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-[(2,4-dichlorophenyl)-phenylmethyl]hydroxylamine is sourced from PubChem (CID 155564614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).