C21H24N8O4S — CID 155564617
5-amino-N-[(E)-1-(4-morpholin-4-ylphenyl)ethylideneamino]-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide (PubChem CID 155564617) has the molecular formula C21H24N8O4S and a molecular weight of 484.54 g/mol. Its IUPAC name is 5-amino-N-[(E)-1-(4-morpholin-4-ylphenyl)ethylideneamino]-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-amino-N-[(E)-1-(4-morpholin-4-ylphenyl)ethylideneamino]-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 155564617 |
| Molecular Formula | C21H24N8O4S |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 5-amino-N-[(E)-1-(4-morpholin-4-ylphenyl)ethylideneamino]-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide |
| SMILES | C/C(=N\NC(=O)c1nc(N)n(-c2ccc(S(N)(=O)=O)cc2)n1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H24N8O4S/c1-14(15-2-4-16(5-3-15)28-10-12-33-13-11-28)25-26-20(30)19-24-21(22)29(27-19)17-6-8-18(9-7-17)34(23,31)32/h2-9H,10-13H2,1H3,(H,26,30)(H2,22,24,27)(H2,23,31,32)/b25-14+ |
| InChIKey | RECXJFPRZAJTIQ-AFUMVMLFSA-N |
| XLogP | 0.49 |
| TPSA | 170.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|