About (3-amino-5-chloro-4,6-dimethylthieno[2,3-b]pyridin-2-yl)-pyridin-3-ylmethanone
(3-amino-5-chloro-4,6-dimethylthieno[2,3-b]pyridin-2-yl)-pyridin-3-ylmethanone (PubChem CID 155564640) has the molecular formula C15H12ClN3OS
and a molecular weight of 317.80 g/mol. Its IUPAC name is (3-amino-5-chloro-4,6-dimethylthieno[2,3-b]pyridin-2-yl)-pyridin-3-ylmethanone.
Molecular Properties
| Compound Name | (3-amino-5-chloro-4,6-dimethylthieno[2,3-b]pyridin-2-yl)-pyridin-3-ylmethanone |
| PubChem CID | 155564640 |
| Molecular Formula | C15H12ClN3OS |
| Molecular Weight | 317.80 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | (3-amino-5-chloro-4,6-dimethylthieno[2,3-b]pyridin-2-yl)-pyridin-3-ylmethanone |
| SMILES | Cc1nc2sc(C(=O)c3cccnc3)c(N)c2c(C)c1Cl |
| InChI | InChI=1S/C15H12ClN3OS/c1-7-10-12(17)14(13(20)9-4-3-5-18-6-9)21-15(10)19-8(2)11(7)16/h3-6H,17H2,1-2H3 |
| InChIKey | ZYYCQADEKMFTKC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.80 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-amino-5-chloro-4,6-dimethylthieno[2,3-b]pyridin-2-yl)-pyridin-3-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-5-chloro-4,6-dimethylthieno[2,3-b]pyridin-2-yl)-pyridin-3-ylmethanone?
The IUPAC name of (3-amino-5-chloro-4,6-dimethylthieno[2,3-b]pyridin-2-yl)-pyridin-3-ylmethanone (CID 155564640) is (3-amino-5-chloro-4,6-dimethylthieno[2,3-b]pyridin-2-yl)-pyridin-3-ylmethanone.
What is the SMILES notation for (3-amino-5-chloro-4,6-dimethylthieno[2,3-b]pyridin-2-yl)-pyridin-3-ylmethanone?
The canonical SMILES for (3-amino-5-chloro-4,6-dimethylthieno[2,3-b]pyridin-2-yl)-pyridin-3-ylmethanone is Cc1nc2sc(C(=O)c3cccnc3)c(N)c2c(C)c1Cl.
What is the InChIKey of (3-amino-5-chloro-4,6-dimethylthieno[2,3-b]pyridin-2-yl)-pyridin-3-ylmethanone?
The InChIKey is ZYYCQADEKMFTKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClN3OS/c1-7-10-12(17)14(13(20)9-4-3-5-18-6-9)21-15(10)19-8(2)11(7)16/h3-6H,17H2,1-2H3.
What are the key properties of (3-amino-5-chloro-4,6-dimethylthieno[2,3-b]pyridin-2-yl)-pyridin-3-ylmethanone?
(3-amino-5-chloro-4,6-dimethylthieno[2,3-b]pyridin-2-yl)-pyridin-3-ylmethanone has a molecular weight of 317.80 g/mol, XLogP of 3.77, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-5-chloro-4,6-dimethylthieno[2,3-b]pyridin-2-yl)-pyridin-3-ylmethanone is sourced from PubChem (CID 155564640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).