C20H23N5O4S2 — CID 155564683
1-[[1-(3,5-dimethyl-4-sulfamoylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-3-phenylthiourea (PubChem CID 155564683) has the molecular formula C20H23N5O4S2 and a molecular weight of 461.57 g/mol. Its IUPAC name is 1-[[1-(3,5-dimethyl-4-sulfamoylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-3-phenylthiourea.
| Compound Name | 1-[[1-(3,5-dimethyl-4-sulfamoylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 155564683 |
| Molecular Formula | C20H23N5O4S2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 1-[[1-(3,5-dimethyl-4-sulfamoylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-3-phenylthiourea |
| SMILES | Cc1cc(N2CC(C(=O)NNC(=S)Nc3ccccc3)CC2=O)cc(C)c1S(N)(=O)=O |
| InChI | InChI=1S/C20H23N5O4S2/c1-12-8-16(9-13(2)18(12)31(21,28)29)25-11-14(10-17(25)26)19(27)23-24-20(30)22-15-6-4-3-5-7-15/h3-9,14H,10-11H2,1-2H3,(H,23,27)(H2,21,28,29)(H2,22,24,30) |
| InChIKey | OWIMCWHOYBJYPJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 133.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|