C17H18ClN5O — CID 155564796
N'-[(3-chlorophenyl)methoxy]-5,6,7-trimethylpyrazolo[1,5-a]pyrimidine-3-carboximidamide (PubChem CID 155564796) has the molecular formula C17H18ClN5O and a molecular weight of 343.82 g/mol. Its IUPAC name is N'-[(3-chlorophenyl)methoxy]-5,6,7-trimethylpyrazolo[1,5-a]pyrimidine-3-carboximidamide.
| Compound Name | N'-[(3-chlorophenyl)methoxy]-5,6,7-trimethylpyrazolo[1,5-a]pyrimidine-3-carboximidamide |
|---|---|
| PubChem CID | 155564796 |
| Molecular Formula | C17H18ClN5O |
| Molecular Weight | 343.82 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N'-[(3-chlorophenyl)methoxy]-5,6,7-trimethylpyrazolo[1,5-a]pyrimidine-3-carboximidamide |
| SMILES | Cc1nc2c(/C(N)=N/OCc3cccc(Cl)c3)cnn2c(C)c1C |
| InChI | InChI=1S/C17H18ClN5O/c1-10-11(2)21-17-15(8-20-23(17)12(10)3)16(19)22-24-9-13-5-4-6-14(18)7-13/h4-8H,9H2,1-3H3,(H2,19,22) |
| InChIKey | YTUDFYOTCWGXRR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 77.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.82 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|