C18H14F6N2O4S — CID 155564875
2-hydroxy-2-methyl-N-[4-nitro-2-(trifluoromethyl)phenyl]-3-[3-(trifluoromethyl)phenyl]sulfanylpropanamide (PubChem CID 155564875) has the molecular formula C18H14F6N2O4S and a molecular weight of 468.38 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-N-[4-nitro-2-(trifluoromethyl)phenyl]-3-[3-(trifluoromethyl)phenyl]sulfanylpropanamide.
| Compound Name | 2-hydroxy-2-methyl-N-[4-nitro-2-(trifluoromethyl)phenyl]-3-[3-(trifluoromethyl)phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 155564875 |
| Molecular Formula | C18H14F6N2O4S |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | 2-hydroxy-2-methyl-N-[4-nitro-2-(trifluoromethyl)phenyl]-3-[3-(trifluoromethyl)phenyl]sulfanylpropanamide |
| SMILES | CC(O)(CSc1cccc(C(F)(F)F)c1)C(=O)Nc1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C18H14F6N2O4S/c1-16(28,9-31-12-4-2-3-10(7-12)17(19,20)21)15(27)25-14-6-5-11(26(29)30)8-13(14)18(22,23)24/h2-8,28H,9H2,1H3,(H,25,27) |
| InChIKey | JMBRREJFMRHDCI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|