C27H36N2O6 — CID 155565048
[(3S,4R,5R,6R)-4,5-diacetyloxy-6-(5-aminopentyl)-1-(naphthalen-1-ylmethyl)piperidin-3-yl] acetate (PubChem CID 155565048) has the molecular formula C27H36N2O6 and a molecular weight of 484.59 g/mol. Its IUPAC name is [(3S,4R,5R,6R)-4,5-diacetyloxy-6-(5-aminopentyl)-1-(naphthalen-1-ylmethyl)piperidin-3-yl] acetate.
| Compound Name | [(3S,4R,5R,6R)-4,5-diacetyloxy-6-(5-aminopentyl)-1-(naphthalen-1-ylmethyl)piperidin-3-yl] acetate |
|---|---|
| PubChem CID | 155565048 |
| Molecular Formula | C27H36N2O6 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | [(3S,4R,5R,6R)-4,5-diacetyloxy-6-(5-aminopentyl)-1-(naphthalen-1-ylmethyl)piperidin-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)[C@@H](CCCCCN)N(Cc2cccc3ccccc23)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H36N2O6/c1-18(30)33-25-17-29(16-22-12-9-11-21-10-6-7-13-23(21)22)24(14-5-4-8-15-28)26(34-19(2)31)27(25)35-20(3)32/h6-7,9-13,24-27H,4-5,8,14-17,28H2,1-3H3/t24-,25+,26-,27-/m1/s1 |
| InChIKey | XFPLXTCMKRDBED-HVWQDESWSA-N |
| XLogP | 3.34 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|