C21H23F3N6O2 — CID 155565075
3-N-[3-(dimethylamino)propyl]-6-nitro-2-N-[[2-(trifluoromethyl)phenyl]methyl]quinoxaline-2,3-diamine (PubChem CID 155565075) has the molecular formula C21H23F3N6O2 and a molecular weight of 448.45 g/mol. Its IUPAC name is 3-N-[3-(dimethylamino)propyl]-6-nitro-2-N-[[2-(trifluoromethyl)phenyl]methyl]quinoxaline-2,3-diamine.
| Compound Name | 3-N-[3-(dimethylamino)propyl]-6-nitro-2-N-[[2-(trifluoromethyl)phenyl]methyl]quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 155565075 |
| Molecular Formula | C21H23F3N6O2 |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 3-N-[3-(dimethylamino)propyl]-6-nitro-2-N-[[2-(trifluoromethyl)phenyl]methyl]quinoxaline-2,3-diamine |
| SMILES | CN(C)CCCNc1nc2cc([N+](=O)[O-])ccc2nc1NCc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H23F3N6O2/c1-29(2)11-5-10-25-19-20(26-13-14-6-3-4-7-16(14)21(22,23)24)27-17-9-8-15(30(31)32)12-18(17)28-19/h3-4,6-9,12H,5,10-11,13H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | PDLZFPQGRVOFGP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|