C16H17N3O3 — CID 155565116
3-methyl-4-(3,4,5-trimethoxyphenyl)-2H-pyrazolo[4,3-c]pyridine (PubChem CID 155565116) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is 3-methyl-4-(3,4,5-trimethoxyphenyl)-2H-pyrazolo[4,3-c]pyridine.
| Compound Name | 3-methyl-4-(3,4,5-trimethoxyphenyl)-2H-pyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 155565116 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 3-methyl-4-(3,4,5-trimethoxyphenyl)-2H-pyrazolo[4,3-c]pyridine |
| SMILES | COc1cc(-c2nccc3n[nH]c(C)c23)cc(OC)c1OC |
| InChI | InChI=1S/C16H17N3O3/c1-9-14-11(19-18-9)5-6-17-15(14)10-7-12(20-2)16(22-4)13(8-10)21-3/h5-8H,1-4H3,(H,18,19) |
| InChIKey | IVHZWMCEBSPXIZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |