C25H16O4 — CID 155565217
2,3-dihydroxy-6-methyl-5-(pyrene-1-carbonyl)cyclohepta-2,4,6-trien-1-one (PubChem CID 155565217) has the molecular formula C25H16O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is 2,3-dihydroxy-6-methyl-5-(pyrene-1-carbonyl)cyclohepta-2,4,6-trien-1-one.
| Compound Name | 2,3-dihydroxy-6-methyl-5-(pyrene-1-carbonyl)cyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 155565217 |
| Molecular Formula | C25H16O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 2,3-dihydroxy-6-methyl-5-(pyrene-1-carbonyl)cyclohepta-2,4,6-trien-1-one |
| SMILES | Cc1cc(=O)c(O)c(O)cc1C(=O)c1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C25H16O4/c1-13-11-20(26)25(29)21(27)12-19(13)24(28)18-10-8-16-6-5-14-3-2-4-15-7-9-17(18)23(16)22(14)15/h2-12H,1H3,(H2,26,27,29) |
| InChIKey | JDXZFBHVKJDWPI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|