C26H39NO5S — CID 155565225
(1S,3S,7S,10R,11S,16R)-7,11-dihydroxy-8,8,10-trimethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-17-oxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 155565225) has the molecular formula C26H39NO5S and a molecular weight of 477.67 g/mol. Its IUPAC name is (1S,3S,7S,10R,11S,16R)-7,11-dihydroxy-8,8,10-trimethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-17-oxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3S,7S,10R,11S,16R)-7,11-dihydroxy-8,8,10-trimethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-17-oxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 155565225 |
| Molecular Formula | C26H39NO5S |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | (1S,3S,7S,10R,11S,16R)-7,11-dihydroxy-8,8,10-trimethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-17-oxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C/C(=C\c1csc(C)n1)[C@@H]1CC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@@H](O)CCCC[C@H]2O[C@H]2C1 |
| InChI | InChI=1S/C26H39NO5S/c1-15(10-19-14-33-17(3)27-19)18-11-20(28)13-24(30)26(4,5)25(31)16(2)21(29)8-6-7-9-22-23(12-18)32-22/h10,14,16,18,21-24,29-30H,6-9,11-13H2,1-5H3/b15-10+/t16-,18-,21+,22-,23+,24+/m1/s1 |
| InChIKey | FSIXTDQFYWKUPE-FIJBMSRBSA-N |
| XLogP | 4.51 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|