C18H12Cl3N3OS — CID 155565358
(7E)-3-(4-chlorophenyl)-7-[(2,4-dichlorophenyl)methylidene]-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one (PubChem CID 155565358) has the molecular formula C18H12Cl3N3OS and a molecular weight of 424.74 g/mol. Its IUPAC name is (7E)-3-(4-chlorophenyl)-7-[(2,4-dichlorophenyl)methylidene]-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one.
| Compound Name | (7E)-3-(4-chlorophenyl)-7-[(2,4-dichlorophenyl)methylidene]-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one |
|---|---|
| PubChem CID | 155565358 |
| Molecular Formula | C18H12Cl3N3OS |
| Molecular Weight | 424.74 g/mol |
| Exact Mass | 422.98 |
| IUPAC Name | (7E)-3-(4-chlorophenyl)-7-[(2,4-dichlorophenyl)methylidene]-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one |
| SMILES | O=c1/c(=C\c2ccc(Cl)cc2Cl)sc2n1CN(c1ccc(Cl)cc1)CN=2 |
| InChI | InChI=1S/C18H12Cl3N3OS/c19-12-3-5-14(6-4-12)23-9-22-18-24(10-23)17(25)16(26-18)7-11-1-2-13(20)8-15(11)21/h1-8H,9-10H2/b16-7+ |
| InChIKey | BHYMUWONDQVUGQ-FRKPEAEDSA-N |
| XLogP | 3.75 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.74 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |