C26H20BrN3O — CID 155565414
3-(4-bromophenyl)-12-methoxy-5-phenyl-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,10(15),11,13-hexaene (PubChem CID 155565414) has the molecular formula C26H20BrN3O and a molecular weight of 470.37 g/mol. Its IUPAC name is 3-(4-bromophenyl)-12-methoxy-5-phenyl-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,10(15),11,13-hexaene.
| Compound Name | 3-(4-bromophenyl)-12-methoxy-5-phenyl-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,10(15),11,13-hexaene |
|---|---|
| PubChem CID | 155565414 |
| Molecular Formula | C26H20BrN3O |
| Molecular Weight | 470.37 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | 3-(4-bromophenyl)-12-methoxy-5-phenyl-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,10(15),11,13-hexaene |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCn1c(-c2ccccc2)nc(-c2ccc(Br)cc2)c1-3 |
| InChI | InChI=1S/C26H20BrN3O/c1-31-19-11-12-22-21(15-19)20-13-14-30-25(24(20)28-22)23(16-7-9-18(27)10-8-16)29-26(30)17-5-3-2-4-6-17/h2-12,15,28H,13-14H2,1H3 |
| InChIKey | APGJNPLHWLOJSL-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.37 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|