C17H23F3N4O2 — CID 155565443
N-(2,2,6,6-tetramethylpiperidin-4-yl)-N'-[5-(trifluoromethyl)-2-pyridinyl]oxamide (PubChem CID 155565443) has the molecular formula C17H23F3N4O2 and a molecular weight of 372.39 g/mol. Its IUPAC name is N-(2,2,6,6-tetramethylpiperidin-4-yl)-N'-[5-(trifluoromethyl)-2-pyridinyl]oxamide.
| Compound Name | N-(2,2,6,6-tetramethylpiperidin-4-yl)-N'-[5-(trifluoromethyl)-2-pyridinyl]oxamide |
|---|---|
| PubChem CID | 155565443 |
| Molecular Formula | C17H23F3N4O2 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | N-(2,2,6,6-tetramethylpiperidin-4-yl)-N'-[5-(trifluoromethyl)-2-pyridinyl]oxamide |
| SMILES | CC1(C)CC(NC(=O)C(=O)Nc2ccc(C(F)(F)F)cn2)CC(C)(C)N1 |
| InChI | InChI=1S/C17H23F3N4O2/c1-15(2)7-11(8-16(3,4)24-15)22-13(25)14(26)23-12-6-5-10(9-21-12)17(18,19)20/h5-6,9,11,24H,7-8H2,1-4H3,(H,22,25)(H,21,23,26) |
| InChIKey | RAELDUDAFQNWLA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|