C30H30N6O2S — CID 155565456
3-[[4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]thieno[2,3-d]pyrimidin-2-yl]amino]piperidin-1-yl]methyl]benzamide (PubChem CID 155565456) has the molecular formula C30H30N6O2S and a molecular weight of 538.68 g/mol. Its IUPAC name is 3-[[4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]thieno[2,3-d]pyrimidin-2-yl]amino]piperidin-1-yl]methyl]benzamide.
| Compound Name | 3-[[4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]thieno[2,3-d]pyrimidin-2-yl]amino]piperidin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 155565456 |
| Molecular Formula | C30H30N6O2S |
| Molecular Weight | 538.68 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | 3-[[4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]thieno[2,3-d]pyrimidin-2-yl]amino]piperidin-1-yl]methyl]benzamide |
| SMILES | Cc1cc(/C=C/C#N)cc(C)c1Oc1nc(NC2CCN(Cc3cccc(C(N)=O)c3)CC2)nc2sccc12 |
| InChI | InChI=1S/C30H30N6O2S/c1-19-15-21(6-4-11-31)16-20(2)26(19)38-28-25-10-14-39-29(25)35-30(34-28)33-24-8-12-36(13-9-24)18-22-5-3-7-23(17-22)27(32)37/h3-7,10,14-17,24H,8-9,12-13,18H2,1-2H3,(H2,32,37)(H,33,34,35)/b6-4+ |
| InChIKey | UGSZNVRYWOXVSO-GQCTYLIASA-N |
| XLogP | 5.81 |
| TPSA | 117.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.68 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|