C20H19F3N4O2 — CID 155565914
N-butan-2-yl-6-methyl-2-[(2,4,5-trifluorobenzoyl)amino]imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 155565914) has the molecular formula C20H19F3N4O2 and a molecular weight of 404.39 g/mol. Its IUPAC name is N-butan-2-yl-6-methyl-2-[(2,4,5-trifluorobenzoyl)amino]imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-butan-2-yl-6-methyl-2-[(2,4,5-trifluorobenzoyl)amino]imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155565914 |
| Molecular Formula | C20H19F3N4O2 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | N-butan-2-yl-6-methyl-2-[(2,4,5-trifluorobenzoyl)amino]imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCC(C)NC(=O)c1c(NC(=O)c2cc(F)c(F)cc2F)nc2ccc(C)cn12 |
| InChI | InChI=1S/C20H19F3N4O2/c1-4-11(3)24-20(29)17-18(25-16-6-5-10(2)9-27(16)17)26-19(28)12-7-14(22)15(23)8-13(12)21/h5-9,11H,4H2,1-3H3,(H,24,29)(H,26,28) |
| InChIKey | OIIOJKUYSGIGNI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|