C20H21FN4O2S — CID 155565921
tert-butyl 3-(3-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-11-carboxylate (PubChem CID 155565921) has the molecular formula C20H21FN4O2S and a molecular weight of 400.48 g/mol. Its IUPAC name is tert-butyl 3-(3-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-11-carboxylate.
| Compound Name | tert-butyl 3-(3-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 155565921 |
| Molecular Formula | C20H21FN4O2S |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | tert-butyl 3-(3-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-11-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c(sc3ncnc(Nc4cccc(F)c4)c23)C1 |
| InChI | InChI=1S/C20H21FN4O2S/c1-20(2,3)27-19(26)25-8-7-14-15(10-25)28-18-16(14)17(22-11-23-18)24-13-6-4-5-12(21)9-13/h4-6,9,11H,7-8,10H2,1-3H3,(H,22,23,24) |
| InChIKey | GWMCQFOBQBLDST-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |