C37H50O4 — CID 155565933
benzyl (1R,2S,5S,8S,10R,14S,15R,16R,18R,21R)-1,2,5,8,15,20,20-heptamethyl-19-oxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-11-ene-8-carboxylate (PubChem CID 155565933) has the molecular formula C37H50O4 and a molecular weight of 558.80 g/mol. Its IUPAC name is benzyl (1R,2S,5S,8S,10R,14S,15R,16R,18R,21R)-1,2,5,8,15,20,20-heptamethyl-19-oxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-11-ene-8-carboxylate.
| Compound Name | benzyl (1R,2S,5S,8S,10R,14S,15R,16R,18R,21R)-1,2,5,8,15,20,20-heptamethyl-19-oxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-11-ene-8-carboxylate |
|---|---|
| PubChem CID | 155565933 |
| Molecular Formula | C37H50O4 |
| Molecular Weight | 558.80 g/mol |
| Exact Mass | 558.37 |
| IUPAC Name | benzyl (1R,2S,5S,8S,10R,14S,15R,16R,18R,21R)-1,2,5,8,15,20,20-heptamethyl-19-oxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-11-ene-8-carboxylate |
| SMILES | CC1(C)C(=O)[C@@H]2O[C@@H]2[C@]2(C)[C@H]3CC=C4[C@@H]5C[C@@](C)(C(=O)OCc6ccccc6)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C37H50O4/c1-32(2)26-15-16-36(6)27(37(26,7)30-28(41-30)29(32)38)14-13-24-25-21-34(4,18-17-33(25,3)19-20-35(24,36)5)31(39)40-22-23-11-9-8-10-12-23/h8-13,25-28,30H,14-22H2,1-7H3/t25-,26-,27-,28-,30-,33+,34-,35+,36+,37-/m0/s1 |
| InChIKey | WPNMFCJJRIIKTJ-YFCIYTGFSA-N |
| XLogP | 8.09 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.80 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|