About 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-1H-pyridin-2-one
4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-1H-pyridin-2-one (PubChem CID 155565957) has the molecular formula C18H14Cl2FN3O2
and a molecular weight of 394.23 g/mol. Its IUPAC name is 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-1H-pyridin-2-one |
| PubChem CID | 155565957 |
| Molecular Formula | C18H14Cl2FN3O2 |
| Molecular Weight | 394.23 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-1H-pyridin-2-one |
| SMILES | CC(Oc1cc(-c2cc[nH]c(=O)c2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C18H14Cl2FN3O2/c1-9(16-12(19)2-3-13(21)17(16)20)26-14-6-11(8-24-18(14)22)10-4-5-23-15(25)7-10/h2-9H,1H3,(H2,22,24)(H,23,25) |
| InChIKey | QDIHRWAROZOBRH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.23 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-1H-pyridin-2-one?
The IUPAC name of 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-1H-pyridin-2-one (CID 155565957) is 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-1H-pyridin-2-one.
What is the SMILES notation for 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-1H-pyridin-2-one?
The canonical SMILES for 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-1H-pyridin-2-one is CC(Oc1cc(-c2cc[nH]c(=O)c2)cnc1N)c1c(Cl)ccc(F)c1Cl.
What is the InChIKey of 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-1H-pyridin-2-one?
The InChIKey is QDIHRWAROZOBRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14Cl2FN3O2/c1-9(16-12(19)2-3-13(21)17(16)20)26-14-6-11(8-24-18(14)22)10-4-5-23-15(25)7-10/h2-9H,1H3,(H2,22,24)(H,23,25).
What are the key properties of 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-1H-pyridin-2-one?
4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-1H-pyridin-2-one has a molecular weight of 394.23 g/mol, XLogP of 4.61, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-1H-pyridin-2-one is sourced from PubChem (CID 155565957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).