C22H25N3O5S — CID 155566005
(2R)-N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 155566005) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is (2R)-N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 155566005 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | (2R)-N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC[C@@H]2C(=O)NC(Cc2ccccc2)C(=O)C(N)=O)cc1 |
| InChI | InChI=1S/C22H25N3O5S/c1-15-9-11-17(12-10-15)31(29,30)25-13-5-8-19(25)22(28)24-18(20(26)21(23)27)14-16-6-3-2-4-7-16/h2-4,6-7,9-12,18-19H,5,8,13-14H2,1H3,(H2,23,27)(H,24,28)/t18?,19-/m1/s1 |
| InChIKey | RXJJNUZQTNCKFP-MUMRKEEXSA-N |
| XLogP | 0.93 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|