C19H16ClN5OS — CID 155566241
2-chloro-N'-(1,4-dimethyl-3-thiophen-2-ylpyrazolo[5,4-b]pyridin-6-yl)benzohydrazide (PubChem CID 155566241) has the molecular formula C19H16ClN5OS and a molecular weight of 397.89 g/mol. Its IUPAC name is 2-chloro-N'-(1,4-dimethyl-3-thiophen-2-ylpyrazolo[5,4-b]pyridin-6-yl)benzohydrazide.
| Compound Name | 2-chloro-N'-(1,4-dimethyl-3-thiophen-2-ylpyrazolo[5,4-b]pyridin-6-yl)benzohydrazide |
|---|---|
| PubChem CID | 155566241 |
| Molecular Formula | C19H16ClN5OS |
| Molecular Weight | 397.89 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 2-chloro-N'-(1,4-dimethyl-3-thiophen-2-ylpyrazolo[5,4-b]pyridin-6-yl)benzohydrazide |
| SMILES | Cc1cc(NNC(=O)c2ccccc2Cl)nc2c1c(-c1cccs1)nn2C |
| InChI | InChI=1S/C19H16ClN5OS/c1-11-10-15(22-23-19(26)12-6-3-4-7-13(12)20)21-18-16(11)17(24-25(18)2)14-8-5-9-27-14/h3-10H,1-2H3,(H,21,22)(H,23,26) |
| InChIKey | PRZYTPBYZCODHS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.89 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|