C40H26F4N4O4 — CID 155566362
3-[[4-[bis(5-hydroxy-1H-indol-3-yl)methyl]-2,3,5,6-tetrafluorophenyl]-(5-hydroxy-1H-indol-3-yl)methyl]-1H-indol-5-ol (PubChem CID 155566362) has the molecular formula C40H26F4N4O4 and a molecular weight of 702.66 g/mol. Its IUPAC name is 3-[[4-[bis(5-hydroxy-1H-indol-3-yl)methyl]-2,3,5,6-tetrafluorophenyl]-(5-hydroxy-1H-indol-3-yl)methyl]-1H-indol-5-ol.
| Compound Name | 3-[[4-[bis(5-hydroxy-1H-indol-3-yl)methyl]-2,3,5,6-tetrafluorophenyl]-(5-hydroxy-1H-indol-3-yl)methyl]-1H-indol-5-ol |
|---|---|
| PubChem CID | 155566362 |
| Molecular Formula | C40H26F4N4O4 |
| Molecular Weight | 702.66 g/mol |
| Exact Mass | 702.19 |
| IUPAC Name | 3-[[4-[bis(5-hydroxy-1H-indol-3-yl)methyl]-2,3,5,6-tetrafluorophenyl]-(5-hydroxy-1H-indol-3-yl)methyl]-1H-indol-5-ol |
| SMILES | Oc1ccc2[nH]cc(C(c3c(F)c(F)c(C(c4c[nH]c5ccc(O)cc45)c4c[nH]c5ccc(O)cc45)c(F)c3F)c3c[nH]c4ccc(O)cc34)c2c1 |
| InChI | InChI=1S/C40H26F4N4O4/c41-37-35(33(25-13-45-29-5-1-17(49)9-21(25)29)26-14-46-30-6-2-18(50)10-22(26)30)38(42)40(44)36(39(37)43)34(27-15-47-31-7-3-19(51)11-23(27)31)28-16-48-32-8-4-20(52)12-24(28)32/h1-16,33-34,45-52H |
| InChIKey | DEOICZBCTSHRHT-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 144.08 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.66 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|