About 1-benzyl-N-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine
1-benzyl-N-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine (PubChem CID 155566464) has the molecular formula C18H16N4O
and a molecular weight of 304.35 g/mol. Its IUPAC name is 1-benzyl-N-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine.
Molecular Properties
| Compound Name | 1-benzyl-N-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine |
| PubChem CID | 155566464 |
| Molecular Formula | C18H16N4O |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 1-benzyl-N-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine |
| SMILES | c1ccc(Cn2c(NCc3ccon3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C18H16N4O/c1-2-6-14(7-3-1)13-22-17-9-5-4-8-16(17)20-18(22)19-12-15-10-11-23-21-15/h1-11H,12-13H2,(H,19,20) |
| InChIKey | ICICNNDYHJYCTL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-benzyl-N-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-N-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine?
The IUPAC name of 1-benzyl-N-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine (CID 155566464) is 1-benzyl-N-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine.
What is the SMILES notation for 1-benzyl-N-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine?
The canonical SMILES for 1-benzyl-N-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine is c1ccc(Cn2c(NCc3ccon3)nc3ccccc32)cc1.
What is the InChIKey of 1-benzyl-N-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine?
The InChIKey is ICICNNDYHJYCTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N4O/c1-2-6-14(7-3-1)13-22-17-9-5-4-8-16(17)20-18(22)19-12-15-10-11-23-21-15/h1-11H,12-13H2,(H,19,20).
What are the key properties of 1-benzyl-N-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine?
1-benzyl-N-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine has a molecular weight of 304.35 g/mol, XLogP of 3.68, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-N-(1,2-oxazol-3-ylmethyl)benzimidazol-2-amine is sourced from PubChem (CID 155566464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).