C23H21N5O — CID 155566496
(E)-3-[3-[5-[(4-cyclopropyl-1,3,5-triazin-2-yl)amino]-2-methylphenoxy]-5-methylphenyl]prop-2-enenitrile (PubChem CID 155566496) has the molecular formula C23H21N5O and a molecular weight of 383.46 g/mol. Its IUPAC name is (E)-3-[3-[5-[(4-cyclopropyl-1,3,5-triazin-2-yl)amino]-2-methylphenoxy]-5-methylphenyl]prop-2-enenitrile.
| Compound Name | (E)-3-[3-[5-[(4-cyclopropyl-1,3,5-triazin-2-yl)amino]-2-methylphenoxy]-5-methylphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 155566496 |
| Molecular Formula | C23H21N5O |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (E)-3-[3-[5-[(4-cyclopropyl-1,3,5-triazin-2-yl)amino]-2-methylphenoxy]-5-methylphenyl]prop-2-enenitrile |
| SMILES | Cc1cc(/C=C/C#N)cc(Oc2cc(Nc3ncnc(C4CC4)n3)ccc2C)c1 |
| InChI | InChI=1S/C23H21N5O/c1-15-10-17(4-3-9-24)12-20(11-15)29-21-13-19(8-5-16(21)2)27-23-26-14-25-22(28-23)18-6-7-18/h3-5,8,10-14,18H,6-7H2,1-2H3,(H,25,26,27,28)/b4-3+ |
| InChIKey | PIYNZBXFFAFNQC-ONEGZZNKSA-N |
| XLogP | 5.44 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|