C32H30O7S — CID 155566520
[acetyloxy-[(1S,2R,3S,4S)-3-(benzenesulfonyl)-1,4-dimethyl-7-oxo-5,6-diphenyl-2-bicyclo[2.2.1]hept-5-enyl]methyl] acetate (PubChem CID 155566520) has the molecular formula C32H30O7S and a molecular weight of 558.65 g/mol. Its IUPAC name is [acetyloxy-[(1S,2R,3S,4S)-3-(benzenesulfonyl)-1,4-dimethyl-7-oxo-5,6-diphenyl-2-bicyclo[2.2.1]hept-5-enyl]methyl] acetate.
| Compound Name | [acetyloxy-[(1S,2R,3S,4S)-3-(benzenesulfonyl)-1,4-dimethyl-7-oxo-5,6-diphenyl-2-bicyclo[2.2.1]hept-5-enyl]methyl] acetate |
|---|---|
| PubChem CID | 155566520 |
| Molecular Formula | C32H30O7S |
| Molecular Weight | 558.65 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | [acetyloxy-[(1S,2R,3S,4S)-3-(benzenesulfonyl)-1,4-dimethyl-7-oxo-5,6-diphenyl-2-bicyclo[2.2.1]hept-5-enyl]methyl] acetate |
| SMILES | CC(=O)OC(OC(C)=O)[C@@H]1[C@H](S(=O)(=O)c2ccccc2)[C@]2(C)C(=O)[C@]1(C)C(c1ccccc1)=C2c1ccccc1 |
| InChI | InChI=1S/C32H30O7S/c1-20(33)38-29(39-21(2)34)27-28(40(36,37)24-18-12-7-13-19-24)32(4)26(23-16-10-6-11-17-23)25(31(27,3)30(32)35)22-14-8-5-9-15-22/h5-19,27-29H,1-4H3/t27-,28-,31+,32+/m0/s1 |
| InChIKey | RFLYSUNWQVZFLA-DSOCELCXSA-N |
| XLogP | 5.12 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.65 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|