About 5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-ethyl-1,3-dimethoxybenzene
5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-ethyl-1,3-dimethoxybenzene (PubChem CID 155566631) has the molecular formula C20H24O4
and a molecular weight of 328.41 g/mol. Its IUPAC name is 5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-ethyl-1,3-dimethoxybenzene.
Molecular Properties
| Compound Name | 5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-ethyl-1,3-dimethoxybenzene |
| PubChem CID | 155566631 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-ethyl-1,3-dimethoxybenzene |
| SMILES | CCc1c(OC)cc(/C=C/c2cc(OC)cc(OC)c2)cc1OC |
| InChI | InChI=1S/C20H24O4/c1-6-18-19(23-4)11-15(12-20(18)24-5)8-7-14-9-16(21-2)13-17(10-14)22-3/h7-13H,6H2,1-5H3/b8-7+ |
| InChIKey | WDQXEKWVZOUZLO-BQYQJAHWSA-N |
| XLogP | 4.45 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-ethyl-1,3-dimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-ethyl-1,3-dimethoxybenzene?
The IUPAC name of 5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-ethyl-1,3-dimethoxybenzene (CID 155566631) is 5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-ethyl-1,3-dimethoxybenzene.
What is the SMILES notation for 5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-ethyl-1,3-dimethoxybenzene?
The canonical SMILES for 5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-ethyl-1,3-dimethoxybenzene is CCc1c(OC)cc(/C=C/c2cc(OC)cc(OC)c2)cc1OC.
What is the InChIKey of 5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-ethyl-1,3-dimethoxybenzene?
The InChIKey is WDQXEKWVZOUZLO-BQYQJAHWSA-N. The full InChI is InChI=1S/C20H24O4/c1-6-18-19(23-4)11-15(12-20(18)24-5)8-7-14-9-16(21-2)13-17(10-14)22-3/h7-13H,6H2,1-5H3/b8-7+.
What are the key properties of 5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-ethyl-1,3-dimethoxybenzene?
5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-ethyl-1,3-dimethoxybenzene has a molecular weight of 328.41 g/mol, XLogP of 4.45, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-ethyl-1,3-dimethoxybenzene is sourced from PubChem (CID 155566631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).