C26H38N4O5 — CID 155566768
2-[(Z)-[(4R,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ylidene]amino]oxy-N-(6-aminohexyl)acetamide (PubChem CID 155566768) has the molecular formula C26H38N4O5 and a molecular weight of 486.61 g/mol. Its IUPAC name is 2-[(Z)-[(4R,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ylidene]amino]oxy-N-(6-aminohexyl)acetamide.
| Compound Name | 2-[(Z)-[(4R,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ylidene]amino]oxy-N-(6-aminohexyl)acetamide |
|---|---|
| PubChem CID | 155566768 |
| Molecular Formula | C26H38N4O5 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | 2-[(Z)-[(4R,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ylidene]amino]oxy-N-(6-aminohexyl)acetamide |
| SMILES | COc1ccc2c3c1O[C@H]1/C(=N\OCC(=O)NCCCCCCN)CC[C@@]4(O)[C@@H](C2)N(C)CC[C@]314 |
| InChI | InChI=1S/C26H38N4O5/c1-30-14-11-25-22-17-7-8-19(33-2)23(22)35-24(25)18(9-10-26(25,32)20(30)15-17)29-34-16-21(31)28-13-6-4-3-5-12-27/h7-8,20,24,32H,3-6,9-16,27H2,1-2H3,(H,28,31)/b29-18-/t20-,24+,25+,26-/m1/s1 |
| InChIKey | XQNZPKPPVZDHBE-JYMHZSFDSA-N |
| XLogP | 1.49 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|