C28H27F3N2O3 — CID 155566789
N-[(2,5-dimethoxyphenyl)methyl]-2,3-dimethyl-1-[[3-(trifluoromethyl)phenyl]methyl]indole-5-carboxamide (PubChem CID 155566789) has the molecular formula C28H27F3N2O3 and a molecular weight of 496.53 g/mol. Its IUPAC name is N-[(2,5-dimethoxyphenyl)methyl]-2,3-dimethyl-1-[[3-(trifluoromethyl)phenyl]methyl]indole-5-carboxamide.
| Compound Name | N-[(2,5-dimethoxyphenyl)methyl]-2,3-dimethyl-1-[[3-(trifluoromethyl)phenyl]methyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 155566789 |
| Molecular Formula | C28H27F3N2O3 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | N-[(2,5-dimethoxyphenyl)methyl]-2,3-dimethyl-1-[[3-(trifluoromethyl)phenyl]methyl]indole-5-carboxamide |
| SMILES | COc1ccc(OC)c(CNC(=O)c2ccc3c(c2)c(C)c(C)n3Cc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C28H27F3N2O3/c1-17-18(2)33(16-19-6-5-7-22(12-19)28(29,30)31)25-10-8-20(14-24(17)25)27(34)32-15-21-13-23(35-3)9-11-26(21)36-4/h5-14H,15-16H2,1-4H3,(H,32,34) |
| InChIKey | MOQQEUVUJIAQSD-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|