C29H32O3 — CID 155566831
benzyl (2R)-2-[(2S,4aS)-7-benzyl-4a,8-dimethyl-1-oxo-2,3,4,7-tetrahydronaphthalen-2-yl]propanoate (PubChem CID 155566831) has the molecular formula C29H32O3 and a molecular weight of 428.57 g/mol. Its IUPAC name is benzyl (2R)-2-[(2S,4aS)-7-benzyl-4a,8-dimethyl-1-oxo-2,3,4,7-tetrahydronaphthalen-2-yl]propanoate.
| Compound Name | benzyl (2R)-2-[(2S,4aS)-7-benzyl-4a,8-dimethyl-1-oxo-2,3,4,7-tetrahydronaphthalen-2-yl]propanoate |
|---|---|
| PubChem CID | 155566831 |
| Molecular Formula | C29H32O3 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | benzyl (2R)-2-[(2S,4aS)-7-benzyl-4a,8-dimethyl-1-oxo-2,3,4,7-tetrahydronaphthalen-2-yl]propanoate |
| SMILES | CC1=C2C(=O)[C@H]([C@@H](C)C(=O)OCc3ccccc3)CC[C@@]2(C)C=CC1Cc1ccccc1 |
| InChI | InChI=1S/C29H32O3/c1-20-24(18-22-10-6-4-7-11-22)14-16-29(3)17-15-25(27(30)26(20)29)21(2)28(31)32-19-23-12-8-5-9-13-23/h4-14,16,21,24-25H,15,17-19H2,1-3H3/t21-,24?,25+,29-/m1/s1 |
| InChIKey | VSTPWLFEMYBSKZ-PURGSNARSA-N |
| XLogP | 6.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|