About benzo[e][1]benzothiole-4,8-dicarbonitrile
benzo[e][1]benzothiole-4,8-dicarbonitrile (PubChem CID 155566836) has the molecular formula C14H6N2S
and a molecular weight of 234.28 g/mol. Its IUPAC name is benzo[e][1]benzothiole-4,8-dicarbonitrile.
Molecular Properties
| Compound Name | benzo[e][1]benzothiole-4,8-dicarbonitrile |
| PubChem CID | 155566836 |
| Molecular Formula | C14H6N2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | benzo[e][1]benzothiole-4,8-dicarbonitrile |
| SMILES | N#Cc1ccc2cc(C#N)c3sccc3c2c1 |
| InChI | InChI=1S/C14H6N2S/c15-7-9-1-2-10-6-11(8-16)14-12(3-4-17-14)13(10)5-9/h1-6H |
| InChIKey | AEMQIAYZNAVXMA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzo[e][1]benzothiole-4,8-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[e][1]benzothiole-4,8-dicarbonitrile?
The IUPAC name of benzo[e][1]benzothiole-4,8-dicarbonitrile (CID 155566836) is benzo[e][1]benzothiole-4,8-dicarbonitrile.
What is the SMILES notation for benzo[e][1]benzothiole-4,8-dicarbonitrile?
The canonical SMILES for benzo[e][1]benzothiole-4,8-dicarbonitrile is N#Cc1ccc2cc(C#N)c3sccc3c2c1.
What is the InChIKey of benzo[e][1]benzothiole-4,8-dicarbonitrile?
The InChIKey is AEMQIAYZNAVXMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H6N2S/c15-7-9-1-2-10-6-11(8-16)14-12(3-4-17-14)13(10)5-9/h1-6H.
What are the key properties of benzo[e][1]benzothiole-4,8-dicarbonitrile?
benzo[e][1]benzothiole-4,8-dicarbonitrile has a molecular weight of 234.28 g/mol, XLogP of 3.80, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[e][1]benzothiole-4,8-dicarbonitrile is sourced from PubChem (CID 155566836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).