About N-[3-[3,5-bis(trifluoromethyl)phenoxy]phenyl]-2-chloro-6-fluorobenzamide
N-[3-[3,5-bis(trifluoromethyl)phenoxy]phenyl]-2-chloro-6-fluorobenzamide (PubChem CID 155567026) has the molecular formula C21H11ClF7NO2
and a molecular weight of 477.76 g/mol. Its IUPAC name is N-[3-[3,5-bis(trifluoromethyl)phenoxy]phenyl]-2-chloro-6-fluorobenzamide.
Molecular Properties
| Compound Name | N-[3-[3,5-bis(trifluoromethyl)phenoxy]phenyl]-2-chloro-6-fluorobenzamide |
| PubChem CID | 155567026 |
| Molecular Formula | C21H11ClF7NO2 |
| Molecular Weight | 477.76 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | N-[3-[3,5-bis(trifluoromethyl)phenoxy]phenyl]-2-chloro-6-fluorobenzamide |
| SMILES | O=C(Nc1cccc(Oc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1)c1c(F)cccc1Cl |
| InChI | InChI=1S/C21H11ClF7NO2/c22-16-5-2-6-17(23)18(16)19(31)30-13-3-1-4-14(10-13)32-15-8-11(20(24,25)26)7-12(9-15)21(27,28)29/h1-10H,(H,30,31) |
| InChIKey | GZXYKAUPKLMMFC-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.76 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[3-[3,5-bis(trifluoromethyl)phenoxy]phenyl]-2-chloro-6-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[3,5-bis(trifluoromethyl)phenoxy]phenyl]-2-chloro-6-fluorobenzamide?
The IUPAC name of N-[3-[3,5-bis(trifluoromethyl)phenoxy]phenyl]-2-chloro-6-fluorobenzamide (CID 155567026) is N-[3-[3,5-bis(trifluoromethyl)phenoxy]phenyl]-2-chloro-6-fluorobenzamide.
What is the SMILES notation for N-[3-[3,5-bis(trifluoromethyl)phenoxy]phenyl]-2-chloro-6-fluorobenzamide?
The canonical SMILES for N-[3-[3,5-bis(trifluoromethyl)phenoxy]phenyl]-2-chloro-6-fluorobenzamide is O=C(Nc1cccc(Oc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1)c1c(F)cccc1Cl.
What is the InChIKey of N-[3-[3,5-bis(trifluoromethyl)phenoxy]phenyl]-2-chloro-6-fluorobenzamide?
The InChIKey is GZXYKAUPKLMMFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H11ClF7NO2/c22-16-5-2-6-17(23)18(16)19(31)30-13-3-1-4-14(10-13)32-15-8-11(20(24,25)26)7-12(9-15)21(27,28)29/h1-10H,(H,30,31).
What are the key properties of N-[3-[3,5-bis(trifluoromethyl)phenoxy]phenyl]-2-chloro-6-fluorobenzamide?
N-[3-[3,5-bis(trifluoromethyl)phenoxy]phenyl]-2-chloro-6-fluorobenzamide has a molecular weight of 477.76 g/mol, XLogP of 7.56, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[3,5-bis(trifluoromethyl)phenoxy]phenyl]-2-chloro-6-fluorobenzamide is sourced from PubChem (CID 155567026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).